C30H36N2O6 — CID 155536986
(4R,5S)-2,4,5-tris(4-ethoxy-3-methoxyphenyl)-4,5-dihydro-1H-imidazole (PubChem CID 155536986) has the molecular formula C30H36N2O6 and a molecular weight of 520.63 g/mol. Its IUPAC name is (4R,5S)-2,4,5-tris(4-ethoxy-3-methoxyphenyl)-4,5-dihydro-1H-imidazole.
| Compound Name | (4R,5S)-2,4,5-tris(4-ethoxy-3-methoxyphenyl)-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 155536986 |
| Molecular Formula | C30H36N2O6 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | (4R,5S)-2,4,5-tris(4-ethoxy-3-methoxyphenyl)-4,5-dihydro-1H-imidazole |
| SMILES | CCOc1ccc(C2=N[C@H](c3ccc(OCC)c(OC)c3)[C@H](c3ccc(OCC)c(OC)c3)N2)cc1OC |
| InChI | InChI=1S/C30H36N2O6/c1-7-36-22-13-10-19(16-25(22)33-4)28-29(20-11-14-23(37-8-2)26(17-20)34-5)32-30(31-28)21-12-15-24(38-9-3)27(18-21)35-6/h10-18,28-29H,7-9H2,1-6H3,(H,31,32)/t28-,29+ |
| InChIKey | MGCAFQCJTQURDJ-ISILISOKSA-N |
| XLogP | 5.74 |
| TPSA | 79.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |