C23H26N6O4 — CID 155537060
N-hydroxy-1-methyl-4-[[(1R,2R)-2-[4-(5-methyl-1H-pyrazol-3-yl)benzoyl]cyclohexanecarbonyl]amino]pyrazole-5-carboxamide (PubChem CID 155537060) has the molecular formula C23H26N6O4 and a molecular weight of 450.50 g/mol. Its IUPAC name is N-hydroxy-1-methyl-4-[[(1R,2R)-2-[4-(5-methyl-1H-pyrazol-3-yl)benzoyl]cyclohexanecarbonyl]amino]pyrazole-5-carboxamide.
| Compound Name | N-hydroxy-1-methyl-4-[[(1R,2R)-2-[4-(5-methyl-1H-pyrazol-3-yl)benzoyl]cyclohexanecarbonyl]amino]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 155537060 |
| Molecular Formula | C23H26N6O4 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | N-hydroxy-1-methyl-4-[[(1R,2R)-2-[4-(5-methyl-1H-pyrazol-3-yl)benzoyl]cyclohexanecarbonyl]amino]pyrazole-5-carboxamide |
| SMILES | Cc1cc(-c2ccc(C(=O)[C@@H]3CCCC[C@H]3C(=O)Nc3cnn(C)c3C(=O)NO)cc2)n[nH]1 |
| InChI | InChI=1S/C23H26N6O4/c1-13-11-18(27-26-13)14-7-9-15(10-8-14)21(30)16-5-3-4-6-17(16)22(31)25-19-12-24-29(2)20(19)23(32)28-33/h7-12,16-17,33H,3-6H2,1-2H3,(H,25,31)(H,26,27)(H,28,32)/t16-,17-/m1/s1 |
| InChIKey | DKULZVGJYQHINL-IAGOWNOFSA-N |
| XLogP | 2.87 |
| TPSA | 142.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|