C22H22N2O3 — CID 155537074
4-[5-[[2-(4-methoxy-1H-indol-3-yl)ethylamino]methyl]furan-2-yl]phenol (PubChem CID 155537074) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is 4-[5-[[2-(4-methoxy-1H-indol-3-yl)ethylamino]methyl]furan-2-yl]phenol.
| Compound Name | 4-[5-[[2-(4-methoxy-1H-indol-3-yl)ethylamino]methyl]furan-2-yl]phenol |
|---|---|
| PubChem CID | 155537074 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 4-[5-[[2-(4-methoxy-1H-indol-3-yl)ethylamino]methyl]furan-2-yl]phenol |
| SMILES | COc1cccc2[nH]cc(CCNCc3ccc(-c4ccc(O)cc4)o3)c12 |
| InChI | InChI=1S/C22H22N2O3/c1-26-21-4-2-3-19-22(21)16(13-24-19)11-12-23-14-18-9-10-20(27-18)15-5-7-17(25)8-6-15/h2-10,13,23-25H,11-12,14H2,1H3 |
| InChIKey | CZLSEABFCZWLAR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|