C29H36N2O5 — CID 155537131
[(1R,5aS,6R,9aS)-1,5a-dimethyl-7-methylidene-3-oxo-6-[(E)-2-(5-oxo-2H-furan-4-yl)ethenyl]-4,5,6,8,9,9a-hexahydro-2H-benzo[c]azepin-1-yl]methyl (2R)-2-amino-3-phenylpropanoate (PubChem CID 155537131) has the molecular formula C29H36N2O5 and a molecular weight of 492.62 g/mol. Its IUPAC name is [(1R,5aS,6R,9aS)-1,5a-dimethyl-7-methylidene-3-oxo-6-[(E)-2-(5-oxo-2H-furan-4-yl)ethenyl]-4,5,6,8,9,9a-hexahydro-2H-benzo[c]azepin-1-yl]methyl (2R)-2-amino-3-phenylpropanoate.
| Compound Name | [(1R,5aS,6R,9aS)-1,5a-dimethyl-7-methylidene-3-oxo-6-[(E)-2-(5-oxo-2H-furan-4-yl)ethenyl]-4,5,6,8,9,9a-hexahydro-2H-benzo[c]azepin-1-yl]methyl (2R)-2-amino-3-phenylpropanoate |
|---|---|
| PubChem CID | 155537131 |
| Molecular Formula | C29H36N2O5 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | [(1R,5aS,6R,9aS)-1,5a-dimethyl-7-methylidene-3-oxo-6-[(E)-2-(5-oxo-2H-furan-4-yl)ethenyl]-4,5,6,8,9,9a-hexahydro-2H-benzo[c]azepin-1-yl]methyl (2R)-2-amino-3-phenylpropanoate |
| SMILES | C=C1CC[C@H]2[C@@](C)(CCC(=O)N[C@@]2(C)COC(=O)[C@H](N)Cc2ccccc2)[C@@H]1/C=C/C1=CCOC1=O |
| InChI | InChI=1S/C29H36N2O5/c1-19-9-12-24-28(2,22(19)11-10-21-14-16-35-26(21)33)15-13-25(32)31-29(24,3)18-36-27(34)23(30)17-20-7-5-4-6-8-20/h4-8,10-11,14,22-24H,1,9,12-13,15-18,30H2,2-3H3,(H,31,32)/b11-10+/t22-,23-,24+,28+,29+/m1/s1 |
| InChIKey | QCCWAGAJSDSGSH-XGKKZYCRSA-N |
| XLogP | 3.40 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|