C31H36O4 — CID 155537241
(2R)-8-[(3E)-4,8-dimethylnona-3,7-dienyl]-5-methoxy-8-methyl-2-phenyl-2,3-dihydropyrano[2,3-h]chromen-4-one (PubChem CID 155537241) has the molecular formula C31H36O4 and a molecular weight of 472.63 g/mol. Its IUPAC name is (2R)-8-[(3E)-4,8-dimethylnona-3,7-dienyl]-5-methoxy-8-methyl-2-phenyl-2,3-dihydropyrano[2,3-h]chromen-4-one.
| Compound Name | (2R)-8-[(3E)-4,8-dimethylnona-3,7-dienyl]-5-methoxy-8-methyl-2-phenyl-2,3-dihydropyrano[2,3-h]chromen-4-one |
|---|---|
| PubChem CID | 155537241 |
| Molecular Formula | C31H36O4 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | (2R)-8-[(3E)-4,8-dimethylnona-3,7-dienyl]-5-methoxy-8-methyl-2-phenyl-2,3-dihydropyrano[2,3-h]chromen-4-one |
| SMILES | COc1cc2c(c3c1C(=O)C[C@H](c1ccccc1)O3)C=CC(C)(CC/C=C(\C)CCC=C(C)C)O2 |
| InChI | InChI=1S/C31H36O4/c1-21(2)11-9-12-22(3)13-10-17-31(4)18-16-24-27(35-31)20-28(33-5)29-25(32)19-26(34-30(24)29)23-14-7-6-8-15-23/h6-8,11,13-16,18,20,26H,9-10,12,17,19H2,1-5H3/b22-13+/t26-,31?/m1/s1 |
| InChIKey | KXZZBHRVPTWYDK-NTWNXEEASA-N |
| XLogP | 8.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|