C25H31N5O4 — CID 155537340
(10R)-4-[4-(4-hydroxypiperidine-1-carbonyl)-2-methoxyanilino]-8-methyl-1,3,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-9-one (PubChem CID 155537340) has the molecular formula C25H31N5O4 and a molecular weight of 465.55 g/mol. Its IUPAC name is (10R)-4-[4-(4-hydroxypiperidine-1-carbonyl)-2-methoxyanilino]-8-methyl-1,3,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-9-one.
| Compound Name | (10R)-4-[4-(4-hydroxypiperidine-1-carbonyl)-2-methoxyanilino]-8-methyl-1,3,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-9-one |
|---|---|
| PubChem CID | 155537340 |
| Molecular Formula | C25H31N5O4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | (10R)-4-[4-(4-hydroxypiperidine-1-carbonyl)-2-methoxyanilino]-8-methyl-1,3,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-9-one |
| SMILES | COc1cc(C(=O)N2CCC(O)CC2)ccc1Nc1ccc2c(n1)N1CCCC[C@@H]1C(=O)N2C |
| InChI | InChI=1S/C25H31N5O4/c1-28-19-8-9-22(27-23(19)30-12-4-3-5-20(30)25(28)33)26-18-7-6-16(15-21(18)34-2)24(32)29-13-10-17(31)11-14-29/h6-9,15,17,20,31H,3-5,10-14H2,1-2H3,(H,26,27)/t20-/m1/s1 |
| InChIKey | CNXZBGZXQVDJRL-HXUWFJFHSA-N |
| XLogP | 2.77 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |