C21H27NO — CID 15553737
5-methyl-2-(2-phenylpropan-2-yl)-1-pyridin-2-ylcyclohexan-1-ol (PubChem CID 15553737) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is 5-methyl-2-(2-phenylpropan-2-yl)-1-pyridin-2-ylcyclohexan-1-ol.
| Compound Name | 5-methyl-2-(2-phenylpropan-2-yl)-1-pyridin-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 15553737 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 5-methyl-2-(2-phenylpropan-2-yl)-1-pyridin-2-ylcyclohexan-1-ol |
| SMILES | CC1CCC(C(C)(C)c2ccccc2)C(O)(c2ccccn2)C1 |
| InChI | InChI=1S/C21H27NO/c1-16-12-13-18(20(2,3)17-9-5-4-6-10-17)21(23,15-16)19-11-7-8-14-22-19/h4-11,14,16,18,23H,12-13,15H2,1-3H3 |
| InChIKey | RUAFMLUBKIIPBK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |