C30H28F3N7O3Se — CID 155537412
N-[6-[4-[5-[[2-(1-methylindol-3-yl)acetyl]amino]-1,3,4-selenadiazol-2-yl]butyl]pyridazin-3-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide (PubChem CID 155537412) has the molecular formula C30H28F3N7O3Se and a molecular weight of 670.55 g/mol. Its IUPAC name is N-[6-[4-[5-[[2-(1-methylindol-3-yl)acetyl]amino]-1,3,4-selenadiazol-2-yl]butyl]pyridazin-3-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | N-[6-[4-[5-[[2-(1-methylindol-3-yl)acetyl]amino]-1,3,4-selenadiazol-2-yl]butyl]pyridazin-3-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 155537412 |
| Molecular Formula | C30H28F3N7O3Se |
| Molecular Weight | 670.55 g/mol |
| Exact Mass | 671.14 |
| IUPAC Name | N-[6-[4-[5-[[2-(1-methylindol-3-yl)acetyl]amino]-1,3,4-selenadiazol-2-yl]butyl]pyridazin-3-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide |
| SMILES | Cn1cc(CC(=O)Nc2nnc(CCCCc3ccc(NC(=O)Cc4cccc(OC(F)(F)F)c4)nn3)[se]2)c2ccccc21 |
| InChI | InChI=1S/C30H28F3N7O3Se/c1-40-18-20(23-10-3-4-11-24(23)40)17-27(42)35-29-39-38-28(44-29)12-5-2-8-21-13-14-25(37-36-21)34-26(41)16-19-7-6-9-22(15-19)43-30(31,32)33/h3-4,6-7,9-11,13-15,18H,2,5,8,12,16-17H2,1H3,(H,34,37,41)(H,35,39,42) |
| InChIKey | KXEMFXKENLKIDH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 123.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.55 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|