About 2-(2-ethoxyphenyl)-[1,3]thiazolo[5,4-c]pyridine
2-(2-ethoxyphenyl)-[1,3]thiazolo[5,4-c]pyridine (PubChem CID 155537416) has the molecular formula C14H12N2OS
and a molecular weight of 256.33 g/mol. Its IUPAC name is 2-(2-ethoxyphenyl)-[1,3]thiazolo[5,4-c]pyridine.
Molecular Properties
| Compound Name | 2-(2-ethoxyphenyl)-[1,3]thiazolo[5,4-c]pyridine |
| PubChem CID | 155537416 |
| Molecular Formula | C14H12N2OS |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 2-(2-ethoxyphenyl)-[1,3]thiazolo[5,4-c]pyridine |
| SMILES | CCOc1ccccc1-c1nc2ccncc2s1 |
| InChI | InChI=1S/C14H12N2OS/c1-2-17-12-6-4-3-5-10(12)14-16-11-7-8-15-9-13(11)18-14/h3-9H,2H2,1H3 |
| InChIKey | PXUQUHFOFBYAHA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-ethoxyphenyl)-[1,3]thiazolo[5,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethoxyphenyl)-[1,3]thiazolo[5,4-c]pyridine?
The IUPAC name of 2-(2-ethoxyphenyl)-[1,3]thiazolo[5,4-c]pyridine (CID 155537416) is 2-(2-ethoxyphenyl)-[1,3]thiazolo[5,4-c]pyridine.
What is the SMILES notation for 2-(2-ethoxyphenyl)-[1,3]thiazolo[5,4-c]pyridine?
The canonical SMILES for 2-(2-ethoxyphenyl)-[1,3]thiazolo[5,4-c]pyridine is CCOc1ccccc1-c1nc2ccncc2s1.
What is the InChIKey of 2-(2-ethoxyphenyl)-[1,3]thiazolo[5,4-c]pyridine?
The InChIKey is PXUQUHFOFBYAHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2OS/c1-2-17-12-6-4-3-5-10(12)14-16-11-7-8-15-9-13(11)18-14/h3-9H,2H2,1H3.
What are the key properties of 2-(2-ethoxyphenyl)-[1,3]thiazolo[5,4-c]pyridine?
2-(2-ethoxyphenyl)-[1,3]thiazolo[5,4-c]pyridine has a molecular weight of 256.33 g/mol, XLogP of 3.76, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethoxyphenyl)-[1,3]thiazolo[5,4-c]pyridine is sourced from PubChem (CID 155537416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).