C20H23NO7 — CID 155537471
N-hydroxy-2-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetamide (PubChem CID 155537471) has the molecular formula C20H23NO7 and a molecular weight of 389.40 g/mol. Its IUPAC name is N-hydroxy-2-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetamide.
| Compound Name | N-hydroxy-2-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 155537471 |
| Molecular Formula | C20H23NO7 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | N-hydroxy-2-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetamide |
| SMILES | C=C(c1ccc(OC)c(OCC(=O)NO)c1)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C20H23NO7/c1-12(14-9-17(25-3)20(27-5)18(10-14)26-4)13-6-7-15(24-2)16(8-13)28-11-19(22)21-23/h6-10,23H,1,11H2,2-5H3,(H,21,22) |
| InChIKey | ZFZCLOSLCZTLPY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|