C21H23ClN2O — CID 155537477
9-[3-(4-chlorophenoxy)propyl]-6-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole (PubChem CID 155537477) has the molecular formula C21H23ClN2O and a molecular weight of 354.88 g/mol. Its IUPAC name is 9-[3-(4-chlorophenoxy)propyl]-6-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole.
| Compound Name | 9-[3-(4-chlorophenoxy)propyl]-6-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 155537477 |
| Molecular Formula | C21H23ClN2O |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 9-[3-(4-chlorophenoxy)propyl]-6-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole |
| SMILES | Cc1ccc2c(c1)c1c(n2CCCOc2ccc(Cl)cc2)CNCC1 |
| InChI | InChI=1S/C21H23ClN2O/c1-15-3-8-20-19(13-15)18-9-10-23-14-21(18)24(20)11-2-12-25-17-6-4-16(22)5-7-17/h3-8,13,23H,2,9-12,14H2,1H3 |
| InChIKey | OYBQOKPYSPQQST-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|