C21H19FN8O4 — CID 155537536
(4'R,6'S,7'S)-18'-fluoro-4',6'-dimethyl-13'-(1,2,4-triazol-1-yl)spiro[1,3-diazinane-5,8'-5-oxa-2,14,16-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),10,12(17),13,15-pentaene]-2,4,6-trione (PubChem CID 155537536) has the molecular formula C21H19FN8O4 and a molecular weight of 466.43 g/mol. Its IUPAC name is (4'R,6'S,7'S)-18'-fluoro-4',6'-dimethyl-13'-(1,2,4-triazol-1-yl)spiro[1,3-diazinane-5,8'-5-oxa-2,14,16-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),10,12(17),13,15-pentaene]-2,4,6-trione.
| Compound Name | (4'R,6'S,7'S)-18'-fluoro-4',6'-dimethyl-13'-(1,2,4-triazol-1-yl)spiro[1,3-diazinane-5,8'-5-oxa-2,14,16-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),10,12(17),13,15-pentaene]-2,4,6-trione |
|---|---|
| PubChem CID | 155537536 |
| Molecular Formula | C21H19FN8O4 |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | (4'R,6'S,7'S)-18'-fluoro-4',6'-dimethyl-13'-(1,2,4-triazol-1-yl)spiro[1,3-diazinane-5,8'-5-oxa-2,14,16-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),10,12(17),13,15-pentaene]-2,4,6-trione |
| SMILES | C[C@@H]1CN2c3c(cc4c(-n5cncn5)ncnc4c3F)CC3(C(=O)NC(=O)NC3=O)[C@H]2[C@H](C)O1 |
| InChI | InChI=1S/C21H19FN8O4/c1-9-5-29-15-11(3-12-14(13(15)22)24-7-25-17(12)30-8-23-6-26-30)4-21(16(29)10(2)34-9)18(31)27-20(33)28-19(21)32/h3,6-10,16H,4-5H2,1-2H3,(H2,27,28,31,32,33)/t9-,10+,16-/m1/s1 |
| InChIKey | PLYLRZHTXIZJAO-KCWFYHRYSA-N |
| XLogP | 0.24 |
| TPSA | 144.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|