C23H20N4O3S — CID 155537665
1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-imidazo[2,1-b][1,3]benzothiazol-2-ylethane-1,2-dione (PubChem CID 155537665) has the molecular formula C23H20N4O3S and a molecular weight of 432.51 g/mol. Its IUPAC name is 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-imidazo[2,1-b][1,3]benzothiazol-2-ylethane-1,2-dione.
| Compound Name | 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-imidazo[2,1-b][1,3]benzothiazol-2-ylethane-1,2-dione |
|---|---|
| PubChem CID | 155537665 |
| Molecular Formula | C23H20N4O3S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-imidazo[2,1-b][1,3]benzothiazol-2-ylethane-1,2-dione |
| SMILES | C[C@@H]1CN(C(=O)c2ccccc2)CCN1C(=O)C(=O)c1cn2c(n1)sc1ccccc12 |
| InChI | InChI=1S/C23H20N4O3S/c1-15-13-25(21(29)16-7-3-2-4-8-16)11-12-26(15)22(30)20(28)17-14-27-18-9-5-6-10-19(18)31-23(27)24-17/h2-10,14-15H,11-13H2,1H3/t15-/m1/s1 |
| InChIKey | ZQKBHVRMDLYUBL-OAHLLOKOSA-N |
| XLogP | 3.10 |
| TPSA | 74.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|