C21H19ClN4O3 — CID 155537673
5-chloro-2-[3-(3,4,5-trimethoxyphenyl)-2H-pyrazolo[3,4-b]pyridin-5-yl]aniline (PubChem CID 155537673) has the molecular formula C21H19ClN4O3 and a molecular weight of 410.86 g/mol. Its IUPAC name is 5-chloro-2-[3-(3,4,5-trimethoxyphenyl)-2H-pyrazolo[3,4-b]pyridin-5-yl]aniline.
| Compound Name | 5-chloro-2-[3-(3,4,5-trimethoxyphenyl)-2H-pyrazolo[3,4-b]pyridin-5-yl]aniline |
|---|---|
| PubChem CID | 155537673 |
| Molecular Formula | C21H19ClN4O3 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 5-chloro-2-[3-(3,4,5-trimethoxyphenyl)-2H-pyrazolo[3,4-b]pyridin-5-yl]aniline |
| SMILES | COc1cc(-c2[nH]nc3ncc(-c4ccc(Cl)cc4N)cc23)cc(OC)c1OC |
| InChI | InChI=1S/C21H19ClN4O3/c1-27-17-7-11(8-18(28-2)20(17)29-3)19-15-6-12(10-24-21(15)26-25-19)14-5-4-13(22)9-16(14)23/h4-10H,23H2,1-3H3,(H,24,25,26) |
| InChIKey | NXHISUBWCDYHLE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 95.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|