C20H18N6O2 — CID 155537741
2-[[1-(2-nitrophenyl)triazol-4-yl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 155537741) has the molecular formula C20H18N6O2 and a molecular weight of 374.40 g/mol. Its IUPAC name is 2-[[1-(2-nitrophenyl)triazol-4-yl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-[[1-(2-nitrophenyl)triazol-4-yl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 155537741 |
| Molecular Formula | C20H18N6O2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-[[1-(2-nitrophenyl)triazol-4-yl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | O=[N+]([O-])c1ccccc1-n1cc(CN2CCc3c([nH]c4ccccc34)C2)nn1 |
| InChI | InChI=1S/C20H18N6O2/c27-26(28)20-8-4-3-7-19(20)25-12-14(22-23-25)11-24-10-9-16-15-5-1-2-6-17(15)21-18(16)13-24/h1-8,12,21H,9-11,13H2 |
| InChIKey | BAQUYKKKIRCVFR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 92.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|