About CID 155537772
CID 155537772 (PubChem CID 155537772) has the molecular formula C6H11O2Se
and a molecular weight of 194.11 g/mol.
Molecular Properties
| Compound Name | CID 155537772 |
| PubChem CID | 155537772 |
| Molecular Formula | C6H11O2Se |
| Molecular Weight | 194.11 g/mol |
| Exact Mass | 194.99 |
| IUPAC Name | — |
| SMILES | C=CCOCC(O)C[Se] |
| InChI | InChI=1S/C6H11O2Se/c1-2-3-8-4-6(7)5-9/h2,6-7H,1,3-5H2 |
| InChIKey | VLFRPQMOSFFUAD-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.11 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 155537772 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155537772?
The IUPAC name of CID 155537772 (CID 155537772) is not available.
What is the SMILES notation for CID 155537772?
The canonical SMILES for CID 155537772 is C=CCOCC(O)C[Se].
What is the InChIKey of CID 155537772?
The InChIKey is VLFRPQMOSFFUAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11O2Se/c1-2-3-8-4-6(7)5-9/h2,6-7H,1,3-5H2.
What are the key properties of CID 155537772?
CID 155537772 has a molecular weight of 194.11 g/mol, XLogP of 0.14, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155537772 is sourced from PubChem (CID 155537772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).