C21H32O2 — CID 155537915
methyl (1Z,5E,7E,11E)-5,11-dimethyl-8-propan-2-ylcyclotetradeca-1,5,7,11-tetraene-1-carboxylate (PubChem CID 155537915) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is methyl (1Z,5E,7E,11E)-5,11-dimethyl-8-propan-2-ylcyclotetradeca-1,5,7,11-tetraene-1-carboxylate.
| Compound Name | methyl (1Z,5E,7E,11E)-5,11-dimethyl-8-propan-2-ylcyclotetradeca-1,5,7,11-tetraene-1-carboxylate |
|---|---|
| PubChem CID | 155537915 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | methyl (1Z,5E,7E,11E)-5,11-dimethyl-8-propan-2-ylcyclotetradeca-1,5,7,11-tetraene-1-carboxylate |
| SMILES | COC(=O)/C1=C\CC/C(C)=C/C=C(/C(C)C)CC/C(C)=C/CC1 |
| InChI | InChI=1S/C21H32O2/c1-16(2)19-14-12-17(3)8-6-10-20(21(22)23-5)11-7-9-18(4)13-15-19/h8,11,13,15-16H,6-7,9-10,12,14H2,1-5H3/b17-8+,18-13+,19-15+,20-11- |
| InChIKey | QOEGJMULHQEINE-HAIHEMRVSA-N |
| XLogP | 5.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|