C27H29N5O7S — CID 155537920
(2E)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[[1-(2-oxo-2-thiomorpholin-4-ylethyl)triazol-4-yl]methylamino]ethylidene]dibenzofuran-1,3-dione (PubChem CID 155537920) has the molecular formula C27H29N5O7S and a molecular weight of 567.62 g/mol. Its IUPAC name is (2E)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[[1-(2-oxo-2-thiomorpholin-4-ylethyl)triazol-4-yl]methylamino]ethylidene]dibenzofuran-1,3-dione.
| Compound Name | (2E)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[[1-(2-oxo-2-thiomorpholin-4-ylethyl)triazol-4-yl]methylamino]ethylidene]dibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 155537920 |
| Molecular Formula | C27H29N5O7S |
| Molecular Weight | 567.62 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | (2E)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[[1-(2-oxo-2-thiomorpholin-4-ylethyl)triazol-4-yl]methylamino]ethylidene]dibenzofuran-1,3-dione |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)/C(=C(/C)NCc3cn(CC(=O)N4CCSCC4)nn3)C(=O)C12C |
| InChI | InChI=1S/C27H29N5O7S/c1-13-23(36)21(15(3)33)25-22(24(13)37)27(4)18(39-25)9-17(34)20(26(27)38)14(2)28-10-16-11-32(30-29-16)12-19(35)31-5-7-40-8-6-31/h9,11,28,36-37H,5-8,10,12H2,1-4H3/b20-14+ |
| InChIKey | HHAZQNQRSYCJNR-XSFVSMFZSA-N |
| XLogP | 1.53 |
| TPSA | 163.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.62 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|