About 3-(1-benzyltetrazol-5-yl)-1-phenyl-9H-pyrido[3,4-b]indole
3-(1-benzyltetrazol-5-yl)-1-phenyl-9H-pyrido[3,4-b]indole (PubChem CID 155538043) has the molecular formula C25H18N6
and a molecular weight of 402.46 g/mol. Its IUPAC name is 3-(1-benzyltetrazol-5-yl)-1-phenyl-9H-pyrido[3,4-b]indole.
Molecular Properties
| Compound Name | 3-(1-benzyltetrazol-5-yl)-1-phenyl-9H-pyrido[3,4-b]indole |
| PubChem CID | 155538043 |
| Molecular Formula | C25H18N6 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 3-(1-benzyltetrazol-5-yl)-1-phenyl-9H-pyrido[3,4-b]indole |
| SMILES | c1ccc(Cn2nnnc2-c2cc3c([nH]c4ccccc43)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C25H18N6/c1-3-9-17(10-4-1)16-31-25(28-29-30-31)22-15-20-19-13-7-8-14-21(19)26-24(20)23(27-22)18-11-5-2-6-12-18/h1-15,26H,16H2 |
| InChIKey | AFDXKGQYLTVDEP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(1-benzyltetrazol-5-yl)-1-phenyl-9H-pyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-benzyltetrazol-5-yl)-1-phenyl-9H-pyrido[3,4-b]indole?
The IUPAC name of 3-(1-benzyltetrazol-5-yl)-1-phenyl-9H-pyrido[3,4-b]indole (CID 155538043) is 3-(1-benzyltetrazol-5-yl)-1-phenyl-9H-pyrido[3,4-b]indole.
What is the SMILES notation for 3-(1-benzyltetrazol-5-yl)-1-phenyl-9H-pyrido[3,4-b]indole?
The canonical SMILES for 3-(1-benzyltetrazol-5-yl)-1-phenyl-9H-pyrido[3,4-b]indole is c1ccc(Cn2nnnc2-c2cc3c([nH]c4ccccc43)c(-c3ccccc3)n2)cc1.
What is the InChIKey of 3-(1-benzyltetrazol-5-yl)-1-phenyl-9H-pyrido[3,4-b]indole?
The InChIKey is AFDXKGQYLTVDEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H18N6/c1-3-9-17(10-4-1)16-31-25(28-29-30-31)22-15-20-19-13-7-8-14-21(19)26-24(20)23(27-22)18-11-5-2-6-12-18/h1-15,26H,16H2.
What are the key properties of 3-(1-benzyltetrazol-5-yl)-1-phenyl-9H-pyrido[3,4-b]indole?
3-(1-benzyltetrazol-5-yl)-1-phenyl-9H-pyrido[3,4-b]indole has a molecular weight of 402.46 g/mol, XLogP of 5.08, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-benzyltetrazol-5-yl)-1-phenyl-9H-pyrido[3,4-b]indole is sourced from PubChem (CID 155538043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).