C46H34N6O4+2 — CID 155538047
4-[10-(4-carboxyphenyl)-15,20-bis(1-methylpyridin-1-ium-4-yl)-21,23-dihydroporphyrin-5-yl]benzoic acid (PubChem CID 155538047) has the molecular formula C46H34N6O4+2 and a molecular weight of 734.82 g/mol. Its IUPAC name is 4-[10-(4-carboxyphenyl)-15,20-bis(1-methylpyridin-1-ium-4-yl)-21,23-dihydroporphyrin-5-yl]benzoic acid.
| Compound Name | 4-[10-(4-carboxyphenyl)-15,20-bis(1-methylpyridin-1-ium-4-yl)-21,23-dihydroporphyrin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 155538047 |
| Molecular Formula | C46H34N6O4+2 |
| Molecular Weight | 734.82 g/mol |
| Exact Mass | 734.26 |
| IUPAC Name | 4-[10-(4-carboxyphenyl)-15,20-bis(1-methylpyridin-1-ium-4-yl)-21,23-dihydroporphyrin-5-yl]benzoic acid |
| SMILES | C[n+]1ccc(-c2c3nc(c(-c4cc[n+](C)cc4)c4ccc([nH]4)c(-c4ccc(C(=O)O)cc4)c4nc(c(-c5ccc(C(=O)O)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C46H32N6O4/c1-51-23-19-29(20-24-51)43-37-15-13-35(48-37)41(27-3-7-31(8-4-27)45(53)54)33-11-12-34(47-33)42(28-5-9-32(10-6-28)46(55)56)36-14-16-38(49-36)44(40-18-17-39(43)50-40)30-21-25-52(2)26-22-30/h3-26H,1-2H3,(H2-,47,48,49,50,53,54,55,56)/p+2/b41-33-,41-35-,42-34-,42-36-,43-37-,43-39-,44-38-,44-40- |
| InChIKey | UPFGUJOYKSRDKN-JAAFTSFNSA-P |
| XLogP | 8.37 |
| TPSA | 139.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.82 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|