C16H22O3 — CID 155538195
(4R,5E,8S,9S)-4-methoxy-5-methyl-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodeca-1(12),5-dien-11-one (PubChem CID 155538195) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (4R,5E,8S,9S)-4-methoxy-5-methyl-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodeca-1(12),5-dien-11-one.
| Compound Name | (4R,5E,8S,9S)-4-methoxy-5-methyl-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodeca-1(12),5-dien-11-one |
|---|---|
| PubChem CID | 155538195 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (4R,5E,8S,9S)-4-methoxy-5-methyl-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodeca-1(12),5-dien-11-one |
| SMILES | C=C(C)[C@@H]1C/C=C(\C)[C@H](OC)CCC2=C[C@@H]1OC2=O |
| InChI | InChI=1S/C16H22O3/c1-10(2)13-7-5-11(3)14(18-4)8-6-12-9-15(13)19-16(12)17/h5,9,13-15H,1,6-8H2,2-4H3/b11-5+/t13-,14+,15-/m0/s1 |
| InChIKey | OFCWVOGQWIXVGJ-UAAWINJSSA-N |
| XLogP | 3.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|