About 4-(3,4-dihydroxyphenyl)-6-(2,4-dimethoxyphenyl)-1H-pyridin-2-one
4-(3,4-dihydroxyphenyl)-6-(2,4-dimethoxyphenyl)-1H-pyridin-2-one (PubChem CID 155538248) has the molecular formula C19H17NO5
and a molecular weight of 339.35 g/mol. Its IUPAC name is 4-(3,4-dihydroxyphenyl)-6-(2,4-dimethoxyphenyl)-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 4-(3,4-dihydroxyphenyl)-6-(2,4-dimethoxyphenyl)-1H-pyridin-2-one |
| PubChem CID | 155538248 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 4-(3,4-dihydroxyphenyl)-6-(2,4-dimethoxyphenyl)-1H-pyridin-2-one |
| SMILES | COc1ccc(-c2cc(-c3ccc(O)c(O)c3)cc(=O)[nH]2)c(OC)c1 |
| InChI | InChI=1S/C19H17NO5/c1-24-13-4-5-14(18(10-13)25-2)15-7-12(9-19(23)20-15)11-3-6-16(21)17(22)8-11/h3-10,21-22H,1-2H3,(H,20,23) |
| InChIKey | KWMCOLLQMRYFFY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,4-dihydroxyphenyl)-6-(2,4-dimethoxyphenyl)-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dihydroxyphenyl)-6-(2,4-dimethoxyphenyl)-1H-pyridin-2-one?
The IUPAC name of 4-(3,4-dihydroxyphenyl)-6-(2,4-dimethoxyphenyl)-1H-pyridin-2-one (CID 155538248) is 4-(3,4-dihydroxyphenyl)-6-(2,4-dimethoxyphenyl)-1H-pyridin-2-one.
What is the SMILES notation for 4-(3,4-dihydroxyphenyl)-6-(2,4-dimethoxyphenyl)-1H-pyridin-2-one?
The canonical SMILES for 4-(3,4-dihydroxyphenyl)-6-(2,4-dimethoxyphenyl)-1H-pyridin-2-one is COc1ccc(-c2cc(-c3ccc(O)c(O)c3)cc(=O)[nH]2)c(OC)c1.
What is the InChIKey of 4-(3,4-dihydroxyphenyl)-6-(2,4-dimethoxyphenyl)-1H-pyridin-2-one?
The InChIKey is KWMCOLLQMRYFFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO5/c1-24-13-4-5-14(18(10-13)25-2)15-7-12(9-19(23)20-15)11-3-6-16(21)17(22)8-11/h3-10,21-22H,1-2H3,(H,20,23).
What are the key properties of 4-(3,4-dihydroxyphenyl)-6-(2,4-dimethoxyphenyl)-1H-pyridin-2-one?
4-(3,4-dihydroxyphenyl)-6-(2,4-dimethoxyphenyl)-1H-pyridin-2-one has a molecular weight of 339.35 g/mol, XLogP of 3.14, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dihydroxyphenyl)-6-(2,4-dimethoxyphenyl)-1H-pyridin-2-one is sourced from PubChem (CID 155538248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).