C28H45N3O3 — CID 155538263
3-[(1S,5R)-8-[6-[2-ethylbutyl-(2-hydroxyacetyl)amino]hexyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide (PubChem CID 155538263) has the molecular formula C28H45N3O3 and a molecular weight of 471.69 g/mol. Its IUPAC name is 3-[(1S,5R)-8-[6-[2-ethylbutyl-(2-hydroxyacetyl)amino]hexyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide.
| Compound Name | 3-[(1S,5R)-8-[6-[2-ethylbutyl-(2-hydroxyacetyl)amino]hexyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide |
|---|---|
| PubChem CID | 155538263 |
| Molecular Formula | C28H45N3O3 |
| Molecular Weight | 471.69 g/mol |
| Exact Mass | 471.35 |
| IUPAC Name | 3-[(1S,5R)-8-[6-[2-ethylbutyl-(2-hydroxyacetyl)amino]hexyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide |
| SMILES | CCC(CC)CN(CCCCCCN1[C@@H]2CC[C@H]1CC(c1cccc(C(N)=O)c1)C2)C(=O)CO |
| InChI | InChI=1S/C28H45N3O3/c1-3-21(4-2)19-30(27(33)20-32)14-7-5-6-8-15-31-25-12-13-26(31)18-24(17-25)22-10-9-11-23(16-22)28(29)34/h9-11,16,21,24-26,32H,3-8,12-15,17-20H2,1-2H3,(H2,29,34)/t24?,25-,26+ |
| InChIKey | CLKVQOVJYMOUKD-NXMIGULDSA-N |
| XLogP | 4.31 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.69 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|