C19H20O5 — CID 155538292
(1R,11R,12S,13R)-11,12-dihydroxy-8,16-dimethyl-14-oxapentacyclo[11.2.2.19,12.01,11.04,10]octadeca-4,7,9-triene-6,15-dione (PubChem CID 155538292) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is (1R,11R,12S,13R)-11,12-dihydroxy-8,16-dimethyl-14-oxapentacyclo[11.2.2.19,12.01,11.04,10]octadeca-4,7,9-triene-6,15-dione.
| Compound Name | (1R,11R,12S,13R)-11,12-dihydroxy-8,16-dimethyl-14-oxapentacyclo[11.2.2.19,12.01,11.04,10]octadeca-4,7,9-triene-6,15-dione |
|---|---|
| PubChem CID | 155538292 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (1R,11R,12S,13R)-11,12-dihydroxy-8,16-dimethyl-14-oxapentacyclo[11.2.2.19,12.01,11.04,10]octadeca-4,7,9-triene-6,15-dione |
| SMILES | Cc1cc(=O)cc2c3c1C[C@]1(O)[C@H]4CC(C)[C@@](CC2)(C(=O)O4)[C@]31O |
| InChI | InChI=1S/C19H20O5/c1-9-5-12(20)7-11-3-4-17-10(2)6-14(24-16(17)21)18(22)8-13(9)15(11)19(17,18)23/h5,7,10,14,22-23H,3-4,6,8H2,1-2H3/t10?,14-,17+,18+,19-/m1/s1 |
| InChIKey | IMEBKOWDDVDWPR-OLAOCLMESA-N |
| XLogP | 0.73 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |