C24H38N4 — CID 155538348
(1S,2S)-N,N,N',N'-tetrapropyl-1,2-dipyridin-2-ylethane-1,2-diamine (PubChem CID 155538348) has the molecular formula C24H38N4 and a molecular weight of 382.60 g/mol. Its IUPAC name is (1S,2S)-N,N,N',N'-tetrapropyl-1,2-dipyridin-2-ylethane-1,2-diamine.
| Compound Name | (1S,2S)-N,N,N',N'-tetrapropyl-1,2-dipyridin-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 155538348 |
| Molecular Formula | C24H38N4 |
| Molecular Weight | 382.60 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | (1S,2S)-N,N,N',N'-tetrapropyl-1,2-dipyridin-2-ylethane-1,2-diamine |
| SMILES | CCCN(CCC)[C@H](c1ccccn1)[C@@H](c1ccccn1)N(CCC)CCC |
| InChI | InChI=1S/C24H38N4/c1-5-17-27(18-6-2)23(21-13-9-11-15-25-21)24(22-14-10-12-16-26-22)28(19-7-3)20-8-4/h9-16,23-24H,5-8,17-20H2,1-4H3/t23-,24-/m1/s1 |
| InChIKey | DYLKNMRHGPNHNA-DNQXCXABSA-N |
| XLogP | 5.50 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.60 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |