C16H11ClN4S — CID 155538383
N-(3-chlorophenyl)-9-thia-3,5,11-triazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaen-4-amine (PubChem CID 155538383) has the molecular formula C16H11ClN4S and a molecular weight of 326.81 g/mol. Its IUPAC name is N-(3-chlorophenyl)-9-thia-3,5,11-triazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaen-4-amine.
| Compound Name | N-(3-chlorophenyl)-9-thia-3,5,11-triazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaen-4-amine |
|---|---|
| PubChem CID | 155538383 |
| Molecular Formula | C16H11ClN4S |
| Molecular Weight | 326.81 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | N-(3-chlorophenyl)-9-thia-3,5,11-triazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaen-4-amine |
| SMILES | Clc1cccc(Nc2ncc3c(n2)-c2cccnc2SC3)c1 |
| InChI | InChI=1S/C16H11ClN4S/c17-11-3-1-4-12(7-11)20-16-19-8-10-9-22-15-13(14(10)21-16)5-2-6-18-15/h1-8H,9H2,(H,19,20,21) |
| InChIKey | PPPPZFZRCLSHTJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.81 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |