About N-(4,4-dimethylcyclohexyl)-4,9-dioxobenzo[f][1]benzofuran-2-carboxamide
N-(4,4-dimethylcyclohexyl)-4,9-dioxobenzo[f][1]benzofuran-2-carboxamide (PubChem CID 155538386) has the molecular formula C21H21NO4
and a molecular weight of 351.40 g/mol. Its IUPAC name is N-(4,4-dimethylcyclohexyl)-4,9-dioxobenzo[f][1]benzofuran-2-carboxamide.
Molecular Properties
| Compound Name | N-(4,4-dimethylcyclohexyl)-4,9-dioxobenzo[f][1]benzofuran-2-carboxamide |
| PubChem CID | 155538386 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | N-(4,4-dimethylcyclohexyl)-4,9-dioxobenzo[f][1]benzofuran-2-carboxamide |
| SMILES | CC1(C)CCC(NC(=O)c2cc3c(o2)C(=O)c2ccccc2C3=O)CC1 |
| InChI | InChI=1S/C21H21NO4/c1-21(2)9-7-12(8-10-21)22-20(25)16-11-15-17(23)13-5-3-4-6-14(13)18(24)19(15)26-16/h3-6,11-12H,7-10H2,1-2H3,(H,22,25) |
| InChIKey | HPGNDGBXUJKDGD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze N-(4,4-dimethylcyclohexyl)-4,9-dioxobenzo[f][1]benzofuran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-dimethylcyclohexyl)-4,9-dioxobenzo[f][1]benzofuran-2-carboxamide?
The IUPAC name of N-(4,4-dimethylcyclohexyl)-4,9-dioxobenzo[f][1]benzofuran-2-carboxamide (CID 155538386) is N-(4,4-dimethylcyclohexyl)-4,9-dioxobenzo[f][1]benzofuran-2-carboxamide.
What is the SMILES notation for N-(4,4-dimethylcyclohexyl)-4,9-dioxobenzo[f][1]benzofuran-2-carboxamide?
The canonical SMILES for N-(4,4-dimethylcyclohexyl)-4,9-dioxobenzo[f][1]benzofuran-2-carboxamide is CC1(C)CCC(NC(=O)c2cc3c(o2)C(=O)c2ccccc2C3=O)CC1.
What is the InChIKey of N-(4,4-dimethylcyclohexyl)-4,9-dioxobenzo[f][1]benzofuran-2-carboxamide?
The InChIKey is HPGNDGBXUJKDGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21NO4/c1-21(2)9-7-12(8-10-21)22-20(25)16-11-15-17(23)13-5-3-4-6-14(13)18(24)19(15)26-16/h3-6,11-12H,7-10H2,1-2H3,(H,22,25).
What are the key properties of N-(4,4-dimethylcyclohexyl)-4,9-dioxobenzo[f][1]benzofuran-2-carboxamide?
N-(4,4-dimethylcyclohexyl)-4,9-dioxobenzo[f][1]benzofuran-2-carboxamide has a molecular weight of 351.40 g/mol, XLogP of 3.75, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-dimethylcyclohexyl)-4,9-dioxobenzo[f][1]benzofuran-2-carboxamide is sourced from PubChem (CID 155538386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).