C22H32O5 — CID 155538434
[(2R,4S,4aS,4bR,7S,8aS,9R)-2-ethenyl-4,7-dihydroxy-2,4b,8,8-tetramethyl-5-oxo-3,4,4a,6,7,8a,9,10-octahydrophenanthren-9-yl] acetate (PubChem CID 155538434) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is [(2R,4S,4aS,4bR,7S,8aS,9R)-2-ethenyl-4,7-dihydroxy-2,4b,8,8-tetramethyl-5-oxo-3,4,4a,6,7,8a,9,10-octahydrophenanthren-9-yl] acetate.
| Compound Name | [(2R,4S,4aS,4bR,7S,8aS,9R)-2-ethenyl-4,7-dihydroxy-2,4b,8,8-tetramethyl-5-oxo-3,4,4a,6,7,8a,9,10-octahydrophenanthren-9-yl] acetate |
|---|---|
| PubChem CID | 155538434 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | [(2R,4S,4aS,4bR,7S,8aS,9R)-2-ethenyl-4,7-dihydroxy-2,4b,8,8-tetramethyl-5-oxo-3,4,4a,6,7,8a,9,10-octahydrophenanthren-9-yl] acetate |
| SMILES | C=C[C@]1(C)C=C2C[C@@H](OC(C)=O)[C@H]3C(C)(C)[C@@H](O)CC(=O)[C@]3(C)[C@H]2[C@@H](O)C1 |
| InChI | InChI=1S/C22H32O5/c1-7-21(5)10-13-8-15(27-12(2)23)19-20(3,4)16(25)9-17(26)22(19,6)18(13)14(24)11-21/h7,10,14-16,18-19,24-25H,1,8-9,11H2,2-6H3/t14-,15+,16-,18+,19-,21+,22+/m0/s1 |
| InChIKey | DBPMKVUWXDCDJI-LBTKGVSOSA-N |
| XLogP | 2.80 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|