C26H33N3O6 — CID 155538488
1-[4-[4-[[(1R,2R,4S,5R,8S,9R,10S,12R,13R)-2-hydroxy-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecan-10-yl]oxymethyl]triazol-1-yl]phenyl]ethanone (PubChem CID 155538488) has the molecular formula C26H33N3O6 and a molecular weight of 483.57 g/mol. Its IUPAC name is 1-[4-[4-[[(1R,2R,4S,5R,8S,9R,10S,12R,13R)-2-hydroxy-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecan-10-yl]oxymethyl]triazol-1-yl]phenyl]ethanone.
| Compound Name | 1-[4-[4-[[(1R,2R,4S,5R,8S,9R,10S,12R,13R)-2-hydroxy-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecan-10-yl]oxymethyl]triazol-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 155538488 |
| Molecular Formula | C26H33N3O6 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 1-[4-[4-[[(1R,2R,4S,5R,8S,9R,10S,12R,13R)-2-hydroxy-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecan-10-yl]oxymethyl]triazol-1-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(-n2cc(CO[C@H]3O[C@@H]4O[C@@]5(C)O[C@]46[C@@H](CC[C@@H](C)[C@@H]6C[C@H]5O)[C@H]3C)nn2)cc1 |
| InChI | InChI=1S/C26H33N3O6/c1-14-5-10-20-15(2)23(33-24-26(20)21(14)11-22(31)25(4,34-24)35-26)32-13-18-12-29(28-27-18)19-8-6-17(7-9-19)16(3)30/h6-9,12,14-15,20-24,31H,5,10-11,13H2,1-4H3/t14-,15-,20+,21+,22-,23+,24-,25+,26+/m1/s1 |
| InChIKey | IKHGFAGZCARSGP-ZTGPCORSSA-N |
| XLogP | 3.23 |
| TPSA | 104.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |