C22H22F3N3O4 — CID 155538549
2-(3,4-dimethoxyphenyl)-5-[2-piperidin-1-yl-5-(trifluoromethoxy)phenyl]-1,3,4-oxadiazole (PubChem CID 155538549) has the molecular formula C22H22F3N3O4 and a molecular weight of 449.43 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5-[2-piperidin-1-yl-5-(trifluoromethoxy)phenyl]-1,3,4-oxadiazole.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5-[2-piperidin-1-yl-5-(trifluoromethoxy)phenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 155538549 |
| Molecular Formula | C22H22F3N3O4 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5-[2-piperidin-1-yl-5-(trifluoromethoxy)phenyl]-1,3,4-oxadiazole |
| SMILES | COc1ccc(-c2nnc(-c3cc(OC(F)(F)F)ccc3N3CCCCC3)o2)cc1OC |
| InChI | InChI=1S/C22H22F3N3O4/c1-29-18-9-6-14(12-19(18)30-2)20-26-27-21(31-20)16-13-15(32-22(23,24)25)7-8-17(16)28-10-4-3-5-11-28/h6-9,12-13H,3-5,10-11H2,1-2H3 |
| InChIKey | BYSXYFYNCUJKEV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 69.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|