About N-[1-oxo-1-phenyl-3-(1,2,4-triazol-1-yl)propan-2-yl]-4-phenylbenzamide
N-[1-oxo-1-phenyl-3-(1,2,4-triazol-1-yl)propan-2-yl]-4-phenylbenzamide (PubChem CID 155538556) has the molecular formula C24H20N4O2
and a molecular weight of 396.45 g/mol. Its IUPAC name is N-[1-oxo-1-phenyl-3-(1,2,4-triazol-1-yl)propan-2-yl]-4-phenylbenzamide.
Molecular Properties
| Compound Name | N-[1-oxo-1-phenyl-3-(1,2,4-triazol-1-yl)propan-2-yl]-4-phenylbenzamide |
| PubChem CID | 155538556 |
| Molecular Formula | C24H20N4O2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N-[1-oxo-1-phenyl-3-(1,2,4-triazol-1-yl)propan-2-yl]-4-phenylbenzamide |
| SMILES | O=C(NC(Cn1cncn1)C(=O)c1ccccc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20N4O2/c29-23(20-9-5-2-6-10-20)22(15-28-17-25-16-26-28)27-24(30)21-13-11-19(12-14-21)18-7-3-1-4-8-18/h1-14,16-17,22H,15H2,(H,27,30) |
| InChIKey | JGRFWFSPQYCKGA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-oxo-1-phenyl-3-(1,2,4-triazol-1-yl)propan-2-yl]-4-phenylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-oxo-1-phenyl-3-(1,2,4-triazol-1-yl)propan-2-yl]-4-phenylbenzamide?
The IUPAC name of N-[1-oxo-1-phenyl-3-(1,2,4-triazol-1-yl)propan-2-yl]-4-phenylbenzamide (CID 155538556) is N-[1-oxo-1-phenyl-3-(1,2,4-triazol-1-yl)propan-2-yl]-4-phenylbenzamide.
What is the SMILES notation for N-[1-oxo-1-phenyl-3-(1,2,4-triazol-1-yl)propan-2-yl]-4-phenylbenzamide?
The canonical SMILES for N-[1-oxo-1-phenyl-3-(1,2,4-triazol-1-yl)propan-2-yl]-4-phenylbenzamide is O=C(NC(Cn1cncn1)C(=O)c1ccccc1)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of N-[1-oxo-1-phenyl-3-(1,2,4-triazol-1-yl)propan-2-yl]-4-phenylbenzamide?
The InChIKey is JGRFWFSPQYCKGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N4O2/c29-23(20-9-5-2-6-10-20)22(15-28-17-25-16-26-28)27-24(30)21-13-11-19(12-14-21)18-7-3-1-4-8-18/h1-14,16-17,22H,15H2,(H,27,30).
What are the key properties of N-[1-oxo-1-phenyl-3-(1,2,4-triazol-1-yl)propan-2-yl]-4-phenylbenzamide?
N-[1-oxo-1-phenyl-3-(1,2,4-triazol-1-yl)propan-2-yl]-4-phenylbenzamide has a molecular weight of 396.45 g/mol, XLogP of 3.63, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-oxo-1-phenyl-3-(1,2,4-triazol-1-yl)propan-2-yl]-4-phenylbenzamide is sourced from PubChem (CID 155538556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).