C15H8Cl3N3S — CID 155538670
(E)-N-[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]-1-(2,4-dichlorophenyl)methanimine (PubChem CID 155538670) has the molecular formula C15H8Cl3N3S and a molecular weight of 368.68 g/mol. Its IUPAC name is (E)-N-[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]-1-(2,4-dichlorophenyl)methanimine.
| Compound Name | (E)-N-[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]-1-(2,4-dichlorophenyl)methanimine |
|---|---|
| PubChem CID | 155538670 |
| Molecular Formula | C15H8Cl3N3S |
| Molecular Weight | 368.68 g/mol |
| Exact Mass | 366.95 |
| IUPAC Name | (E)-N-[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]-1-(2,4-dichlorophenyl)methanimine |
| SMILES | Clc1ccc(-c2nnc(/N=C/c3ccc(Cl)cc3Cl)s2)cc1 |
| InChI | InChI=1S/C15H8Cl3N3S/c16-11-4-1-9(2-5-11)14-20-21-15(22-14)19-8-10-3-6-12(17)7-13(10)18/h1-8H/b19-8+ |
| InChIKey | OVKISKAHFJKGMO-UFWORHAWSA-N |
| XLogP | 5.92 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.68 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|