C18H17Cl2NO2 — CID 155538948
(3-benzylpyrrolidin-1-yl)-(2,4-dichloro-6-hydroxyphenyl)methanone (PubChem CID 155538948) has the molecular formula C18H17Cl2NO2 and a molecular weight of 350.25 g/mol. Its IUPAC name is (3-benzylpyrrolidin-1-yl)-(2,4-dichloro-6-hydroxyphenyl)methanone.
| Compound Name | (3-benzylpyrrolidin-1-yl)-(2,4-dichloro-6-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 155538948 |
| Molecular Formula | C18H17Cl2NO2 |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | (3-benzylpyrrolidin-1-yl)-(2,4-dichloro-6-hydroxyphenyl)methanone |
| SMILES | O=C(c1c(O)cc(Cl)cc1Cl)N1CCC(Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H17Cl2NO2/c19-14-9-15(20)17(16(22)10-14)18(23)21-7-6-13(11-21)8-12-4-2-1-3-5-12/h1-5,9-10,13,22H,6-8,11H2 |
| InChIKey | VCRGMVPGHBLRIQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |