C15H17N3O — CID 155538966
3-(2-amino-8-methyl-5,6,7,8-tetrahydroquinazolin-4-yl)phenol (PubChem CID 155538966) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is 3-(2-amino-8-methyl-5,6,7,8-tetrahydroquinazolin-4-yl)phenol.
| Compound Name | 3-(2-amino-8-methyl-5,6,7,8-tetrahydroquinazolin-4-yl)phenol |
|---|---|
| PubChem CID | 155538966 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 3-(2-amino-8-methyl-5,6,7,8-tetrahydroquinazolin-4-yl)phenol |
| SMILES | CC1CCCc2c(-c3cccc(O)c3)nc(N)nc21 |
| InChI | InChI=1S/C15H17N3O/c1-9-4-2-7-12-13(9)17-15(16)18-14(12)10-5-3-6-11(19)8-10/h3,5-6,8-9,19H,2,4,7H2,1H3,(H2,16,17,18) |
| InChIKey | JDCXNNSDFFPWPI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |