C26H41NO3 — CID 155539014
methyl (2S)-2-[[(1R,4aR,4bR,10aR)-1-methyl-7-propan-2-yl-3,4,4a,4b,5,6,10,10a-octahydro-2H-phenanthrene-1-carbonyl]amino]-3-methylpentanoate (PubChem CID 155539014) has the molecular formula C26H41NO3 and a molecular weight of 415.62 g/mol. Its IUPAC name is methyl (2S)-2-[[(1R,4aR,4bR,10aR)-1-methyl-7-propan-2-yl-3,4,4a,4b,5,6,10,10a-octahydro-2H-phenanthrene-1-carbonyl]amino]-3-methylpentanoate.
| Compound Name | methyl (2S)-2-[[(1R,4aR,4bR,10aR)-1-methyl-7-propan-2-yl-3,4,4a,4b,5,6,10,10a-octahydro-2H-phenanthrene-1-carbonyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 155539014 |
| Molecular Formula | C26H41NO3 |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.31 |
| IUPAC Name | methyl (2S)-2-[[(1R,4aR,4bR,10aR)-1-methyl-7-propan-2-yl-3,4,4a,4b,5,6,10,10a-octahydro-2H-phenanthrene-1-carbonyl]amino]-3-methylpentanoate |
| SMILES | CCC(C)[C@H](NC(=O)[C@]1(C)CCC[C@H]2[C@H]1CC=C1C=C(C(C)C)CC[C@@H]12)C(=O)OC |
| InChI | InChI=1S/C26H41NO3/c1-7-17(4)23(24(28)30-6)27-25(29)26(5)14-8-9-21-20-12-10-18(16(2)3)15-19(20)11-13-22(21)26/h11,15-17,20-23H,7-10,12-14H2,1-6H3,(H,27,29)/t17?,20-,21+,22+,23-,26+/m0/s1 |
| InChIKey | VSCOYGHZRMTWSQ-LBCAZGMFSA-N |
| XLogP | 5.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |