C22H34O4 — CID 155539335
(E)-4-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-2-(2-ethoxy-2-oxoethyl)but-2-enoic acid (PubChem CID 155539335) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is (E)-4-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-2-(2-ethoxy-2-oxoethyl)but-2-enoic acid.
| Compound Name | (E)-4-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-2-(2-ethoxy-2-oxoethyl)but-2-enoic acid |
|---|---|
| PubChem CID | 155539335 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | (E)-4-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-2-(2-ethoxy-2-oxoethyl)but-2-enoic acid |
| SMILES | C=C1CC[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1C/C=C(\CC(=O)OCC)C(=O)O |
| InChI | InChI=1S/C22H34O4/c1-6-26-19(23)14-16(20(24)25)9-10-17-15(2)8-11-18-21(3,4)12-7-13-22(17,18)5/h9,17-18H,2,6-8,10-14H2,1,3-5H3,(H,24,25)/b16-9+/t17-,18-,22+/m0/s1 |
| InChIKey | IWADPZYDBFXVRP-OXNXFDESSA-N |
| XLogP | 5.14 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|