C21H32O2 — CID 155539353
(1R,3R,9S,10S,11R,14R)-9-hydroxy-5,5,10,15-tetramethyltetracyclo[12.2.1.01,11.03,10]heptadec-15-en-4-one (PubChem CID 155539353) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is (1R,3R,9S,10S,11R,14R)-9-hydroxy-5,5,10,15-tetramethyltetracyclo[12.2.1.01,11.03,10]heptadec-15-en-4-one.
| Compound Name | (1R,3R,9S,10S,11R,14R)-9-hydroxy-5,5,10,15-tetramethyltetracyclo[12.2.1.01,11.03,10]heptadec-15-en-4-one |
|---|---|
| PubChem CID | 155539353 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (1R,3R,9S,10S,11R,14R)-9-hydroxy-5,5,10,15-tetramethyltetracyclo[12.2.1.01,11.03,10]heptadec-15-en-4-one |
| SMILES | CC1=C[C@]23C[C@H]1CC[C@H]2[C@]1(C)[C@@H](O)CCCC(C)(C)C(=O)[C@@H]1C3 |
| InChI | InChI=1S/C21H32O2/c1-13-10-21-11-14(13)7-8-16(21)20(4)15(12-21)18(23)19(2,3)9-5-6-17(20)22/h10,14-17,22H,5-9,11-12H2,1-4H3/t14-,15+,16+,17+,20-,21-/m1/s1 |
| InChIKey | VDNJKRMUWMVLRX-QBUOIHNDSA-N |
| XLogP | 4.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|