C21H17F5N2 — CID 155539386
1-methyl-3-[2,2,3,3,3-pentafluoro-1-(1-methylindol-3-yl)propyl]indole (PubChem CID 155539386) has the molecular formula C21H17F5N2 and a molecular weight of 392.37 g/mol. Its IUPAC name is 1-methyl-3-[2,2,3,3,3-pentafluoro-1-(1-methylindol-3-yl)propyl]indole.
| Compound Name | 1-methyl-3-[2,2,3,3,3-pentafluoro-1-(1-methylindol-3-yl)propyl]indole |
|---|---|
| PubChem CID | 155539386 |
| Molecular Formula | C21H17F5N2 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 1-methyl-3-[2,2,3,3,3-pentafluoro-1-(1-methylindol-3-yl)propyl]indole |
| SMILES | Cn1cc(C(c2cn(C)c3ccccc23)C(F)(F)C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C21H17F5N2/c1-27-11-15(13-7-3-5-9-17(13)27)19(20(22,23)21(24,25)26)16-12-28(2)18-10-6-4-8-14(16)18/h3-12,19H,1-2H3 |
| InChIKey | VAGYVUXAMHUYFO-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|