C24H39N — CID 155539542
(1R,3aR,4S,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-N-phenyl-1,2,3,3a,4,5,6,7-octahydroinden-4-amine (PubChem CID 155539542) has the molecular formula C24H39N and a molecular weight of 341.58 g/mol. Its IUPAC name is (1R,3aR,4S,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-N-phenyl-1,2,3,3a,4,5,6,7-octahydroinden-4-amine.
| Compound Name | (1R,3aR,4S,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-N-phenyl-1,2,3,3a,4,5,6,7-octahydroinden-4-amine |
|---|---|
| PubChem CID | 155539542 |
| Molecular Formula | C24H39N |
| Molecular Weight | 341.58 g/mol |
| Exact Mass | 341.31 |
| IUPAC Name | (1R,3aR,4S,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-N-phenyl-1,2,3,3a,4,5,6,7-octahydroinden-4-amine |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H](Nc3ccccc3)CCC[C@]12C |
| InChI | InChI=1S/C24H39N/c1-18(2)10-8-11-19(3)21-15-16-22-23(14-9-17-24(21,22)4)25-20-12-6-5-7-13-20/h5-7,12-13,18-19,21-23,25H,8-11,14-17H2,1-4H3/t19-,21-,22+,23+,24-/m1/s1 |
| InChIKey | YTXBHZJKDMAVIP-SAKKWRDPSA-N |
| XLogP | 7.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.58 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |