About [5-(4-methylsulfonylphenyl)-6,6-diphenylhex-5-enyl] nitrate
[5-(4-methylsulfonylphenyl)-6,6-diphenylhex-5-enyl] nitrate (PubChem CID 155539669) has the molecular formula C25H25NO5S
and a molecular weight of 451.54 g/mol. Its IUPAC name is [5-(4-methylsulfonylphenyl)-6,6-diphenylhex-5-enyl] nitrate.
Molecular Properties
| Compound Name | [5-(4-methylsulfonylphenyl)-6,6-diphenylhex-5-enyl] nitrate |
| PubChem CID | 155539669 |
| Molecular Formula | C25H25NO5S |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | [5-(4-methylsulfonylphenyl)-6,6-diphenylhex-5-enyl] nitrate |
| SMILES | CS(=O)(=O)c1ccc(C(CCCCO[N+](=O)[O-])=C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25NO5S/c1-32(29,30)23-17-15-20(16-18-23)24(14-8-9-19-31-26(27)28)25(21-10-4-2-5-11-21)22-12-6-3-7-13-22/h2-7,10-13,15-18H,8-9,14,19H2,1H3 |
| InChIKey | FRTMSTLLVUVSOS-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze [5-(4-methylsulfonylphenyl)-6,6-diphenylhex-5-enyl] nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-methylsulfonylphenyl)-6,6-diphenylhex-5-enyl] nitrate?
The IUPAC name of [5-(4-methylsulfonylphenyl)-6,6-diphenylhex-5-enyl] nitrate (CID 155539669) is [5-(4-methylsulfonylphenyl)-6,6-diphenylhex-5-enyl] nitrate.
What is the SMILES notation for [5-(4-methylsulfonylphenyl)-6,6-diphenylhex-5-enyl] nitrate?
The canonical SMILES for [5-(4-methylsulfonylphenyl)-6,6-diphenylhex-5-enyl] nitrate is CS(=O)(=O)c1ccc(C(CCCCO[N+](=O)[O-])=C(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of [5-(4-methylsulfonylphenyl)-6,6-diphenylhex-5-enyl] nitrate?
The InChIKey is FRTMSTLLVUVSOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25NO5S/c1-32(29,30)23-17-15-20(16-18-23)24(14-8-9-19-31-26(27)28)25(21-10-4-2-5-11-21)22-12-6-3-7-13-22/h2-7,10-13,15-18H,8-9,14,19H2,1H3.
What are the key properties of [5-(4-methylsulfonylphenyl)-6,6-diphenylhex-5-enyl] nitrate?
[5-(4-methylsulfonylphenyl)-6,6-diphenylhex-5-enyl] nitrate has a molecular weight of 451.54 g/mol, XLogP of 5.43, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-methylsulfonylphenyl)-6,6-diphenylhex-5-enyl] nitrate is sourced from PubChem (CID 155539669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).