C20H18N4O3S2 — CID 155539837
5-cyclopropyl-N-[1-[4-(hydroxycarbamoyl)phenyl]cyclopropyl]-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 155539837) has the molecular formula C20H18N4O3S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 5-cyclopropyl-N-[1-[4-(hydroxycarbamoyl)phenyl]cyclopropyl]-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 5-cyclopropyl-N-[1-[4-(hydroxycarbamoyl)phenyl]cyclopropyl]-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 155539837 |
| Molecular Formula | C20H18N4O3S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 5-cyclopropyl-N-[1-[4-(hydroxycarbamoyl)phenyl]cyclopropyl]-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NO)c1ccc(C2(NC(=O)c3nc(-c4nccs4)sc3C3CC3)CC2)cc1 |
| InChI | InChI=1S/C20H18N4O3S2/c25-16(24-27)12-3-5-13(6-4-12)20(7-8-20)23-17(26)14-15(11-1-2-11)29-19(22-14)18-21-9-10-28-18/h3-6,9-11,27H,1-2,7-8H2,(H,23,26)(H,24,25) |
| InChIKey | WVCZRDIDYOCLED-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|