C20H32O3 — CID 155539904
(4aS,6aS,7S,11aR,11bS)-7-hydroxy-4,4,11b-trimethyl-1,2,3,4a,5,6,7,8,9,10,11,11a-dodecahydrocyclohepta[a]naphthalene-6a,9-dicarbaldehyde (PubChem CID 155539904) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (4aS,6aS,7S,11aR,11bS)-7-hydroxy-4,4,11b-trimethyl-1,2,3,4a,5,6,7,8,9,10,11,11a-dodecahydrocyclohepta[a]naphthalene-6a,9-dicarbaldehyde.
| Compound Name | (4aS,6aS,7S,11aR,11bS)-7-hydroxy-4,4,11b-trimethyl-1,2,3,4a,5,6,7,8,9,10,11,11a-dodecahydrocyclohepta[a]naphthalene-6a,9-dicarbaldehyde |
|---|---|
| PubChem CID | 155539904 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (4aS,6aS,7S,11aR,11bS)-7-hydroxy-4,4,11b-trimethyl-1,2,3,4a,5,6,7,8,9,10,11,11a-dodecahydrocyclohepta[a]naphthalene-6a,9-dicarbaldehyde |
| SMILES | CC1(C)CCC[C@]2(C)[C@H]3CCC(C=O)C[C@H](O)[C@]3(C=O)CC[C@@H]12 |
| InChI | InChI=1S/C20H32O3/c1-18(2)8-4-9-19(3)15(18)7-10-20(13-22)16(19)6-5-14(12-21)11-17(20)23/h12-17,23H,4-11H2,1-3H3/t14?,15-,16+,17-,19-,20-/m0/s1 |
| InChIKey | OCPCPPBNCIFJAI-DXBIYESQSA-N |
| XLogP | 3.77 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|