C23H22FN7O2 — CID 155540021
1-[4-(4-amino-7-prop-2-ynylpyrrolo[2,3-d]pyrimidin-5-yl)-2-fluorophenyl]-3-(5-tert-butyl-1,2-oxazol-3-yl)urea (PubChem CID 155540021) has the molecular formula C23H22FN7O2 and a molecular weight of 447.47 g/mol. Its IUPAC name is 1-[4-(4-amino-7-prop-2-ynylpyrrolo[2,3-d]pyrimidin-5-yl)-2-fluorophenyl]-3-(5-tert-butyl-1,2-oxazol-3-yl)urea.
| Compound Name | 1-[4-(4-amino-7-prop-2-ynylpyrrolo[2,3-d]pyrimidin-5-yl)-2-fluorophenyl]-3-(5-tert-butyl-1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 155540021 |
| Molecular Formula | C23H22FN7O2 |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 1-[4-(4-amino-7-prop-2-ynylpyrrolo[2,3-d]pyrimidin-5-yl)-2-fluorophenyl]-3-(5-tert-butyl-1,2-oxazol-3-yl)urea |
| SMILES | C#CCn1cc(-c2ccc(NC(=O)Nc3cc(C(C)(C)C)on3)c(F)c2)c2c(N)ncnc21 |
| InChI | InChI=1S/C23H22FN7O2/c1-5-8-31-11-14(19-20(25)26-12-27-21(19)31)13-6-7-16(15(24)9-13)28-22(32)29-18-10-17(33-30-18)23(2,3)4/h1,6-7,9-12H,8H2,2-4H3,(H2,25,26,27)(H2,28,29,30,32) |
| InChIKey | SRWPMNYYSPDNFI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 123.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|