C23H32F3N3Si — CID 155540068
1-[[1-cyclohexyl-5-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]methyl]-4,4-dimethyl-1,4-azasilinane (PubChem CID 155540068) has the molecular formula C23H32F3N3Si and a molecular weight of 435.61 g/mol. Its IUPAC name is 1-[[1-cyclohexyl-5-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]methyl]-4,4-dimethyl-1,4-azasilinane.
| Compound Name | 1-[[1-cyclohexyl-5-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]methyl]-4,4-dimethyl-1,4-azasilinane |
|---|---|
| PubChem CID | 155540068 |
| Molecular Formula | C23H32F3N3Si |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 1-[[1-cyclohexyl-5-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]methyl]-4,4-dimethyl-1,4-azasilinane |
| SMILES | C[Si]1(C)CCN(Cc2cc(-c3ccc(C(F)(F)F)cc3)n(C3CCCCC3)n2)CC1 |
| InChI | InChI=1S/C23H32F3N3Si/c1-30(2)14-12-28(13-15-30)17-20-16-22(29(27-20)21-6-4-3-5-7-21)18-8-10-19(11-9-18)23(24,25)26/h8-11,16,21H,3-7,12-15,17H2,1-2H3 |
| InChIKey | KWICTXLYMFFNGS-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|