C19H17F3N4O2 — CID 155540261
N-butyl-2-[(2,3,6-trifluorobenzoyl)amino]imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 155540261) has the molecular formula C19H17F3N4O2 and a molecular weight of 390.37 g/mol. Its IUPAC name is N-butyl-2-[(2,3,6-trifluorobenzoyl)amino]imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-butyl-2-[(2,3,6-trifluorobenzoyl)amino]imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155540261 |
| Molecular Formula | C19H17F3N4O2 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | N-butyl-2-[(2,3,6-trifluorobenzoyl)amino]imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCCCNC(=O)c1c(NC(=O)c2c(F)ccc(F)c2F)nc2ccccn12 |
| InChI | InChI=1S/C19H17F3N4O2/c1-2-3-9-23-19(28)16-17(24-13-6-4-5-10-26(13)16)25-18(27)14-11(20)7-8-12(21)15(14)22/h4-8,10H,2-3,9H2,1H3,(H,23,28)(H,25,27) |
| InChIKey | PAWFGKMFIDEQQT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|