About (5S)-1-(4-fluorophenyl)-1'-phenylspiro[4H-indazole-5,6'-cyclohexene]
(5S)-1-(4-fluorophenyl)-1'-phenylspiro[4H-indazole-5,6'-cyclohexene] (PubChem CID 155540268) has the molecular formula C24H21FN2
and a molecular weight of 356.44 g/mol. Its IUPAC name is (5S)-1-(4-fluorophenyl)-1'-phenylspiro[4H-indazole-5,6'-cyclohexene].
Molecular Properties
| Compound Name | (5S)-1-(4-fluorophenyl)-1'-phenylspiro[4H-indazole-5,6'-cyclohexene] |
| PubChem CID | 155540268 |
| Molecular Formula | C24H21FN2 |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | (5S)-1-(4-fluorophenyl)-1'-phenylspiro[4H-indazole-5,6'-cyclohexene] |
| SMILES | Fc1ccc(-n2ncc3c2C=C[C@]2(CCCC=C2c2ccccc2)C3)cc1 |
| InChI | InChI=1S/C24H21FN2/c25-20-9-11-21(12-10-20)27-23-13-15-24(16-19(23)17-26-27)14-5-4-8-22(24)18-6-2-1-3-7-18/h1-3,6-13,15,17H,4-5,14,16H2/t24-/m1/s1 |
| InChIKey | BMXRHVHPOUJMAM-XMMPIXPASA-N |
| XLogP | 5.83 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-1-(4-fluorophenyl)-1'-phenylspiro[4H-indazole-5,6'-cyclohexene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-1-(4-fluorophenyl)-1'-phenylspiro[4H-indazole-5,6'-cyclohexene]?
The IUPAC name of (5S)-1-(4-fluorophenyl)-1'-phenylspiro[4H-indazole-5,6'-cyclohexene] (CID 155540268) is (5S)-1-(4-fluorophenyl)-1'-phenylspiro[4H-indazole-5,6'-cyclohexene].
What is the SMILES notation for (5S)-1-(4-fluorophenyl)-1'-phenylspiro[4H-indazole-5,6'-cyclohexene]?
The canonical SMILES for (5S)-1-(4-fluorophenyl)-1'-phenylspiro[4H-indazole-5,6'-cyclohexene] is Fc1ccc(-n2ncc3c2C=C[C@]2(CCCC=C2c2ccccc2)C3)cc1.
What is the InChIKey of (5S)-1-(4-fluorophenyl)-1'-phenylspiro[4H-indazole-5,6'-cyclohexene]?
The InChIKey is BMXRHVHPOUJMAM-XMMPIXPASA-N. The full InChI is InChI=1S/C24H21FN2/c25-20-9-11-21(12-10-20)27-23-13-15-24(16-19(23)17-26-27)14-5-4-8-22(24)18-6-2-1-3-7-18/h1-3,6-13,15,17H,4-5,14,16H2/t24-/m1/s1.
What are the key properties of (5S)-1-(4-fluorophenyl)-1'-phenylspiro[4H-indazole-5,6'-cyclohexene]?
(5S)-1-(4-fluorophenyl)-1'-phenylspiro[4H-indazole-5,6'-cyclohexene] has a molecular weight of 356.44 g/mol, XLogP of 5.83, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-1-(4-fluorophenyl)-1'-phenylspiro[4H-indazole-5,6'-cyclohexene] is sourced from PubChem (CID 155540268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).