C64H58N4O4 — CID 155540494
5-[(Z)-2-methoxy-3-(4-propan-2-ylphenyl)but-1-enoxy]pentyl 4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)benzoate (PubChem CID 155540494) has the molecular formula C64H58N4O4 and a molecular weight of 947.19 g/mol. Its IUPAC name is 5-[(Z)-2-methoxy-3-(4-propan-2-ylphenyl)but-1-enoxy]pentyl 4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)benzoate.
| Compound Name | 5-[(Z)-2-methoxy-3-(4-propan-2-ylphenyl)but-1-enoxy]pentyl 4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)benzoate |
|---|---|
| PubChem CID | 155540494 |
| Molecular Formula | C64H58N4O4 |
| Molecular Weight | 947.19 g/mol |
| Exact Mass | 946.45 |
| IUPAC Name | 5-[(Z)-2-methoxy-3-(4-propan-2-ylphenyl)but-1-enoxy]pentyl 4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)benzoate |
| SMILES | CO/C(=C\OCCCCCOC(=O)c1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc1)C(C)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C64H58N4O4/c1-42(2)44-23-25-45(26-24-44)43(3)59(70-4)41-71-39-15-8-16-40-72-64(69)50-29-27-49(28-30-50)63-57-37-35-55(67-57)61(47-19-11-6-12-20-47)53-33-31-51(65-53)60(46-17-9-5-10-18-46)52-32-34-54(66-52)62(48-21-13-7-14-22-48)56-36-38-58(63)68-56/h5-7,9-14,17-38,41-43,65,68H,8,15-16,39-40H2,1-4H3/b59-41-,60-51-,60-52-,61-53-,61-55-,62-54-,62-56-,63-57-,63-58- |
| InChIKey | RIGPTQDKTCZRPH-BEVLABRNSA-N |
| XLogP | 16.08 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.19 |
| LogP ≤ 5 | 16.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|