About [2-(4-amino-6-anilino-1,3,5-triazin-2-yl)phenyl]methanol
[2-(4-amino-6-anilino-1,3,5-triazin-2-yl)phenyl]methanol (PubChem CID 155540592) has the molecular formula C16H15N5O
and a molecular weight of 293.33 g/mol. Its IUPAC name is [2-(4-amino-6-anilino-1,3,5-triazin-2-yl)phenyl]methanol.
Molecular Properties
| Compound Name | [2-(4-amino-6-anilino-1,3,5-triazin-2-yl)phenyl]methanol |
| PubChem CID | 155540592 |
| Molecular Formula | C16H15N5O |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | [2-(4-amino-6-anilino-1,3,5-triazin-2-yl)phenyl]methanol |
| SMILES | Nc1nc(Nc2ccccc2)nc(-c2ccccc2CO)n1 |
| InChI | InChI=1S/C16H15N5O/c17-15-19-14(13-9-5-4-6-11(13)10-22)20-16(21-15)18-12-7-2-1-3-8-12/h1-9,22H,10H2,(H3,17,18,19,20,21) |
| InChIKey | CGTJWKRPSFTZJS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(4-amino-6-anilino-1,3,5-triazin-2-yl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-amino-6-anilino-1,3,5-triazin-2-yl)phenyl]methanol?
The IUPAC name of [2-(4-amino-6-anilino-1,3,5-triazin-2-yl)phenyl]methanol (CID 155540592) is [2-(4-amino-6-anilino-1,3,5-triazin-2-yl)phenyl]methanol.
What is the SMILES notation for [2-(4-amino-6-anilino-1,3,5-triazin-2-yl)phenyl]methanol?
The canonical SMILES for [2-(4-amino-6-anilino-1,3,5-triazin-2-yl)phenyl]methanol is Nc1nc(Nc2ccccc2)nc(-c2ccccc2CO)n1.
What is the InChIKey of [2-(4-amino-6-anilino-1,3,5-triazin-2-yl)phenyl]methanol?
The InChIKey is CGTJWKRPSFTZJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N5O/c17-15-19-14(13-9-5-4-6-11(13)10-22)20-16(21-15)18-12-7-2-1-3-8-12/h1-9,22H,10H2,(H3,17,18,19,20,21).
What are the key properties of [2-(4-amino-6-anilino-1,3,5-triazin-2-yl)phenyl]methanol?
[2-(4-amino-6-anilino-1,3,5-triazin-2-yl)phenyl]methanol has a molecular weight of 293.33 g/mol, XLogP of 2.36, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-amino-6-anilino-1,3,5-triazin-2-yl)phenyl]methanol is sourced from PubChem (CID 155540592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).