C17H11N3O6S — CID 155540665
2-[[3-(3-nitrophenyl)-1,2-oxazol-5-yl]methyl]-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 155540665) has the molecular formula C17H11N3O6S and a molecular weight of 385.36 g/mol. Its IUPAC name is 2-[[3-(3-nitrophenyl)-1,2-oxazol-5-yl]methyl]-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-[[3-(3-nitrophenyl)-1,2-oxazol-5-yl]methyl]-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 155540665 |
| Molecular Formula | C17H11N3O6S |
| Molecular Weight | 385.36 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 2-[[3-(3-nitrophenyl)-1,2-oxazol-5-yl]methyl]-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | O=C1c2ccccc2S(=O)(=O)N1Cc1cc(-c2cccc([N+](=O)[O-])c2)no1 |
| InChI | InChI=1S/C17H11N3O6S/c21-17-14-6-1-2-7-16(14)27(24,25)19(17)10-13-9-15(18-26-13)11-4-3-5-12(8-11)20(22)23/h1-9H,10H2 |
| InChIKey | YZCQBEDJOIIXFO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 123.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|