C32H34ClN3O4 — CID 155540817
16,17-dimethoxy-19-[[4-(4-methylphenyl)piperazin-1-yl]methyl]-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene chloride (PubChem CID 155540817) has the molecular formula C32H34ClN3O4 and a molecular weight of 560.09 g/mol. Its IUPAC name is 16,17-dimethoxy-19-[[4-(4-methylphenyl)piperazin-1-yl]methyl]-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene chloride.
| Compound Name | 16,17-dimethoxy-19-[[4-(4-methylphenyl)piperazin-1-yl]methyl]-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene chloride |
|---|---|
| PubChem CID | 155540817 |
| Molecular Formula | C32H34ClN3O4 |
| Molecular Weight | 560.09 g/mol |
| Exact Mass | 559.22 |
| IUPAC Name | 16,17-dimethoxy-19-[[4-(4-methylphenyl)piperazin-1-yl]methyl]-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene chloride |
| SMILES | COc1cc(CN2CCN(c3ccc(C)cc3)CC2)c2cc3[n+](cc2c1OC)CCc1cc2c(cc1-3)OCO2.[Cl-] |
| InChI | InChI=1S/C32H34N3O4.ClH/c1-21-4-6-24(7-5-21)34-12-10-33(11-13-34)18-23-15-31(36-2)32(37-3)27-19-35-9-8-22-14-29-30(39-20-38-29)17-26(22)28(35)16-25(23)27;/h4-7,14-17,19H,8-13,18,20H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | JLHZENMRILSNFA-UHFFFAOYSA-M |
| XLogP | 1.73 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.09 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|